CAS 2241875-91-0 is the registry number for (2–((propan–2–yl–d7)oxy)pyridin–4–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)-4-pyridinyl]boronic acid (CAS 2241875-91-0) is a chemical compound with the molecular formula C8H12BNO3 and a molecular weight of 188.04 g/mol. IUPAC name: [2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)-4-pyridinyl]boronic acid. InChIKey: KXFOVGZGIPWHTK-NWOXSKRJSA-N.
| Molecular formula | C8H12BNO3 |
|---|---|
| Molecular weight | 188.04 g/mol |
| IUPAC name | [2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)-4-pyridinyl]boronic acid |
| InChIKey | KXFOVGZGIPWHTK-NWOXSKRJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])OC1=NC=CC(=C1)B(O)O |
Computed by PubChem (NCBI)