CAS 2242739-41-7 is the registry number for Carbetamide D5 (phenyl D5) 100 µg/mL in Acetone. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
[(2R)-1-(ethylamino)-1-oxopropan-2-yl] N-(2,3,4,5,6-pentadeuteriophenyl)carbamate (CAS 2242739-41-7) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 241.30 g/mol. IUPAC name: [(2R)-1-(ethylamino)-1-oxopropan-2-yl] N-(2,3,4,5,6-pentadeuteriophenyl)carbamate. InChIKey: AMRQXHFXNZFDCH-NLPHKMMGSA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 241.30 g/mol |
| IUPAC name | [(2R)-1-(ethylamino)-1-oxopropan-2-yl] N-(2,3,4,5,6-pentadeuteriophenyl)carbamate |
| InChIKey | AMRQXHFXNZFDCH-NLPHKMMGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NC(=O)O[C@H](C)C(=O)NCC)[2H])[2H] |
Computed by PubChem (NCBI)