CAS 2243-67-6 appears in our catalog under these names: Naphthalene–2,6–diamine, Naphthalene-2,6-diamine, >98.0%(HPLC)(T), Naphthalene-2,6-diamine 95%, 2,6-Naphthalenediamine, 95%, 95%, naphthalene-2,6-diamine, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g.
Naphthalene-2,6-diamine (CAS 2243-67-6) is a chemical compound with the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. IUPAC name: naphthalene-2,6-diamine. InChIKey: GOGZBMRXLADNEV-UHFFFAOYSA-N.
| Molecular formula | C10H10N2 |
|---|---|
| Molecular weight | 158.20 g/mol |
| IUPAC name | naphthalene-2,6-diamine |
| InChIKey | GOGZBMRXLADNEV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)N)C=C1N |
Computed by PubChem (NCBI)