CAS 2243504-98-3 appears in our catalog under these names: 2-Methoxypyridine-4-sulfonyl fluoride, 95%, 2-Methoxypyridine-4-sulfonyl fluoride. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 25mg, 50mg, 100mg, 500mg.
2-methoxypyridine-4-sulfonyl fluoride (CAS 2243504-98-3) is a chemical compound with the molecular formula C6H6FNO3S and a molecular weight of 191.18 g/mol. IUPAC name: 2-methoxypyridine-4-sulfonyl fluoride. InChIKey: HVISTANXDBKYRO-UHFFFAOYSA-N.
| Molecular formula | C6H6FNO3S |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 2-methoxypyridine-4-sulfonyl fluoride |
| InChIKey | HVISTANXDBKYRO-UHFFFAOYSA-N |
| SMILES | COC1=NC=CC(=C1)S(=O)(=O)F |
Computed by PubChem (NCBI)