Products 38962-61-7
CAS 38962-61-7 appears in our catalog under these names: 5-Amino-2-fluorobenzenesulfonic acid, 95%, 95%, 5-Amino-2-fluorobenzenesulfonic acid, 95+%, 5-Amino-2-fluorobenzenesulfonic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-Amino-2-fluorobenzenesulfonic acid, 95%, 95%
Chemat- size: 100mg, 250mg, 1g
- Variants: 3
from 467.60
5-amino-2-fluorobenzenesulfonic acid (CAS 38962-61-7) is a chemical compound with the molecular formula C6H6FNO3S and a molecular weight of 191.18 g/mol. IUPAC name: 5-amino-2-fluorobenzenesulfonic acid. InChIKey: JXRZCHPTZXGPTD-UHFFFAOYSA-N.
| Molecular formula | C6H6FNO3S |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 5-amino-2-fluorobenzenesulfonic acid |
| InChIKey | JXRZCHPTZXGPTD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)S(=O)(=O)O)F |
Computed by PubChem (NCBI)