Products 2245686-69-3
CAS 2245686-69-3 is the registry number for 3-aminophenyl sulfurofluoridate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-amino-3-fluorosulfonyloxybenzene (CAS 2245686-69-3) is a chemical compound with the molecular formula C6H6FNO3S and a molecular weight of 191.18 g/mol. IUPAC name: 1-amino-3-fluorosulfonyloxybenzene. InChIKey: KGNNSDZTJPVJPV-UHFFFAOYSA-N.
| Molecular formula | C6H6FNO3S |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 1-amino-3-fluorosulfonyloxybenzene |
| InChIKey | KGNNSDZTJPVJPV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OS(=O)(=O)F)N |
Computed by PubChem (NCBI)