Products 2243506-58-1
CAS 2243506-58-1 is the registry number for rac-tert-Butyl (1R,3S,4S)-3-amino-4-hydroxycyclopentane-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl (1R,3S,4S)-3-amino-4-hydroxycyclopentane-1-carboxylate;hydrochloride (CAS 2243506-58-1) is a chemical compound with the molecular formula C10H20ClNO3 and a molecular weight of 237.72 g/mol. IUPAC name: tert-butyl (1R,3S,4S)-3-amino-4-hydroxycyclopentane-1-carboxylate;hydrochloride. InChIKey: SXPTZWQZLUDMTE-MWDCIYOWSA-N.
| Molecular formula | C10H20ClNO3 |
|---|---|
| Molecular weight | 237.72 g/mol |
| IUPAC name | tert-butyl (1R,3S,4S)-3-amino-4-hydroxycyclopentane-1-carboxylate;hydrochloride |
| InChIKey | SXPTZWQZLUDMTE-MWDCIYOWSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@@H]([C@H](C1)O)N.Cl |
Computed by PubChem (NCBI)