Products 2243507-54-0
CAS 2243507-54-0 is the registry number for (5-(Piperidin-1-yl)-1,3,4-oxadiazol-2-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(5-piperidin-1-yl-1,3,4-oxadiazol-2-yl)methanamine;dihydrochloride (CAS 2243507-54-0) is a chemical compound with the molecular formula C8H16Cl2N4O and a molecular weight of 255.14 g/mol. IUPAC name: (5-piperidin-1-yl-1,3,4-oxadiazol-2-yl)methanamine;dihydrochloride. InChIKey: OFSLPZQWCFMFDZ-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2N4O |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | (5-piperidin-1-yl-1,3,4-oxadiazol-2-yl)methanamine;dihydrochloride |
| InChIKey | OFSLPZQWCFMFDZ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=NN=C(O2)CN.Cl.Cl |
Computed by PubChem (NCBI)