CAS 2243509-33-1 appears in our catalog under these names: 2-Amino-3-(5-chloropyridin-3-yl)propanoic acid dihydrochloride, 98%, 2-Amino-3-(5-chloropyridin-3-yl)propanoic acid dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
2-amino-3-(5-chloro-3-pyridinyl)propanoic acid;dihydrochloride (CAS 2243509-33-1) is a chemical compound with the molecular formula C8H11Cl3N2O2 and a molecular weight of 273.5 g/mol. IUPAC name: 2-amino-3-(5-chloro-3-pyridinyl)propanoic acid;dihydrochloride. InChIKey: SIZIAGKMMMDBFH-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl3N2O2 |
|---|---|
| Molecular weight | 273.5 g/mol |
| IUPAC name | 2-amino-3-(5-chloro-3-pyridinyl)propanoic acid;dihydrochloride |
| InChIKey | SIZIAGKMMMDBFH-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1Cl)CC(C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)