Products 2701679-69-6

CAS 2701679-69-6 is the registry number for (S)-2-Amino-3-(6-chloropyridin-3-yl)propanoic acid dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2S)-2-amino-3-(6-chloro-3-pyridinyl)propanoic acid;dihydrochloride (CAS 2701679-69-6) is a chemical compound with the molecular formula C8H11Cl3N2O2 and a molecular weight of 273.5 g/mol. IUPAC name: (2S)-2-amino-3-(6-chloro-3-pyridinyl)propanoic acid;dihydrochloride. InChIKey: YHNVKRBWDOZBTN-ILKKLZGPSA-N.

Identity
Molecular formulaC8H11Cl3N2O2
Molecular weight273.5 g/mol
IUPAC name(2S)-2-amino-3-(6-chloro-3-pyridinyl)propanoic acid;dihydrochloride
InChIKeyYHNVKRBWDOZBTN-ILKKLZGPSA-N
SMILESC1=CC(=NC=C1C[C@@H](C(=O)O)N)Cl.Cl.Cl

Computed by PubChem (NCBI)