CAS 2701679-69-6 is the registry number for (S)-2-Amino-3-(6-chloropyridin-3-yl)propanoic acid dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-3-(6-chloro-3-pyridinyl)propanoic acid;dihydrochloride (CAS 2701679-69-6) is a chemical compound with the molecular formula C8H11Cl3N2O2 and a molecular weight of 273.5 g/mol. IUPAC name: (2S)-2-amino-3-(6-chloro-3-pyridinyl)propanoic acid;dihydrochloride. InChIKey: YHNVKRBWDOZBTN-ILKKLZGPSA-N.
| Molecular formula | C8H11Cl3N2O2 |
|---|---|
| Molecular weight | 273.5 g/mol |
| IUPAC name | (2S)-2-amino-3-(6-chloro-3-pyridinyl)propanoic acid;dihydrochloride |
| InChIKey | YHNVKRBWDOZBTN-ILKKLZGPSA-N |
| SMILES | C1=CC(=NC=C1C[C@@H](C(=O)O)N)Cl.Cl.Cl |
Computed by PubChem (NCBI)