Products 2361638-21-1

CAS 2361638-21-1 is the registry number for 2-Amino-3-(4-chloropyridin-2-yl)propanoic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-amino-3-(4-chloro-2-pyridinyl)propanoic acid;dihydrochloride (CAS 2361638-21-1) is a chemical compound with the molecular formula C8H11Cl3N2O2 and a molecular weight of 273.5 g/mol. IUPAC name: 2-amino-3-(4-chloro-2-pyridinyl)propanoic acid;dihydrochloride. InChIKey: SRUNATAOTMXPNG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11Cl3N2O2
Molecular weight273.5 g/mol
IUPAC name2-amino-3-(4-chloro-2-pyridinyl)propanoic acid;dihydrochloride
InChIKeySRUNATAOTMXPNG-UHFFFAOYSA-N
SMILESC1=CN=C(C=C1Cl)CC(C(=O)O)N.Cl.Cl

Computed by PubChem (NCBI)