Products 2243512-01-6
CAS 2243512-01-6 is the registry number for rac-(3R,5R)-1-((tert-Butoxy)carbonyl)-5-tert-butylpiperidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3R,5R)-5-tert-butyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 2243512-01-6) is a chemical compound with the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. IUPAC name: (3R,5R)-5-tert-butyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: POVQYQNPYGOQKD-MNOVXSKESA-N.
| Molecular formula | C15H27NO4 |
|---|---|
| Molecular weight | 285.38 g/mol |
| IUPAC name | (3R,5R)-5-tert-butyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | POVQYQNPYGOQKD-MNOVXSKESA-N |
| SMILES | CC(C)(C)[C@H]1C[C@H](CN(C1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)