CAS 2243512-26-5 is the registry number for rac-(1R,3S,4S)-3-Amino-4-hydroxycyclopentane-1-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1S,3R,4R)-3-amino-4-hydroxycyclopentane-1-carboxylic acid;hydrochloride (CAS 2243512-26-5) is a chemical compound with the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. IUPAC name: (1S,3R,4R)-3-amino-4-hydroxycyclopentane-1-carboxylic acid;hydrochloride. InChIKey: NPUIVIVVLYVOIR-UJPDDDSFSA-N.
| Molecular formula | C6H12ClNO3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | (1S,3R,4R)-3-amino-4-hydroxycyclopentane-1-carboxylic acid;hydrochloride |
| InChIKey | NPUIVIVVLYVOIR-UJPDDDSFSA-N |
| SMILES | C1[C@@H](C[C@H]([C@@H]1N)O)C(=O)O.Cl |
Computed by PubChem (NCBI)