CAS 2244702-64-3 is the registry number for TGase2-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-amino-2-[4-(1-propan-2-ylpiperidin-4-yl)oxyphenyl]quinoline-5,8-dione (CAS 2244702-64-3) is a chemical compound with the molecular formula C23H25N3O3 and a molecular weight of 391.5 g/mol. IUPAC name: 7-amino-2-[4-(1-propan-2-ylpiperidin-4-yl)oxyphenyl]quinoline-5,8-dione. InChIKey: LJPOPXHJMVJSCD-UHFFFAOYSA-N.
| Molecular formula | C23H25N3O3 |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | 7-amino-2-[4-(1-propan-2-ylpiperidin-4-yl)oxyphenyl]quinoline-5,8-dione |
| InChIKey | LJPOPXHJMVJSCD-UHFFFAOYSA-N |
| SMILES | CC(C)N1CCC(CC1)OC2=CC=C(C=C2)C3=NC4=C(C=C3)C(=O)C=C(C4=O)N |
Computed by PubChem (NCBI)