Products 635701-59-6
CAS 635701-59-6 is the registry number for CAY10734. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 1 mg, 25 mg, 5 mg, 10 mg.
1-[[4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]azetidine-3-carboxylic acid (CAS 635701-59-6) is a chemical compound with the molecular formula C23H25N3O3 and a molecular weight of 391.5 g/mol. IUPAC name: 1-[[4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]azetidine-3-carboxylic acid. InChIKey: SHQNRSGKLNMHOS-UHFFFAOYSA-N.
| Molecular formula | C23H25N3O3 |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | 1-[[4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]azetidine-3-carboxylic acid |
| InChIKey | SHQNRSGKLNMHOS-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C2=NC(=NO2)C3=CC=C(C=C3)CN4CC(C4)C(=O)O |
Computed by PubChem (NCBI)