CAS 2351843-48-4 appears in our catalog under these names: RAS inhibitor Abd-7, 97%, RAS inhibitor Abd–7, RAS inhibitor Abd-7, RAS inhibitor Abd-7, 99.16%, 99.16%, RAS inhibitor Abd-7, 99.57%. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 100mg, 10mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 2mg, 1mg.
6-(2,3-dihydro-1,4-benzodioxin-5-yl)-N-[4-[(dimethylamino)methyl]phenyl]-2-methoxypyridin-3-amine (CAS 2351843-48-4) is a chemical compound with the molecular formula C23H25N3O3 and a molecular weight of 391.5 g/mol. IUPAC name: 6-(2,3-dihydro-1,4-benzodioxin-5-yl)-N-[4-[(dimethylamino)methyl]phenyl]-2-methoxypyridin-3-amine. InChIKey: MJHHFDJNRRCUOB-UHFFFAOYSA-N.
| Molecular formula | C23H25N3O3 |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | 6-(2,3-dihydro-1,4-benzodioxin-5-yl)-N-[4-[(dimethylamino)methyl]phenyl]-2-methoxypyridin-3-amine |
| InChIKey | MJHHFDJNRRCUOB-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CC=C(C=C1)NC2=C(N=C(C=C2)C3=C4C(=CC=C3)OCCO4)OC |
Computed by PubChem (NCBI)