CAS 2244888-87-5 is the registry number for N-((3R,4R,5R,6R)-2,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-3-yl)pent-4-ynamide, 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg.
N-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]pent-4-ynamide (CAS 2244888-87-5) is a chemical compound with the molecular formula C11H17NO6 and a molecular weight of 259.26 g/mol. IUPAC name: N-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]pent-4-ynamide. InChIKey: KFJNGXGIGJWRMC-YKVPTUPCSA-N.
| Molecular formula | C11H17NO6 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | N-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]pent-4-ynamide |
| InChIKey | KFJNGXGIGJWRMC-YKVPTUPCSA-N |
| SMILES | C#CCCC(=O)N[C@@H]1[C@H]([C@H]([C@H](OC1O)CO)O)O |
Computed by PubChem (NCBI)