CAS 224645-82-3 appears in our catalog under these names: Boc-(r)-gamma-allyl-l-proline, 95%, (2S,4R)-4-Allyl-1-(tert-butoxycarbonyl)pyrrolidine-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
(2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-prop-2-enylpyrrolidine-2-carboxylic acid (CAS 224645-82-3) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: (2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-prop-2-enylpyrrolidine-2-carboxylic acid. InChIKey: CYODNDBPPDGALB-ZJUUUORDSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | (2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-prop-2-enylpyrrolidine-2-carboxylic acid |
| InChIKey | CYODNDBPPDGALB-ZJUUUORDSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)O)CC=C |
Computed by PubChem (NCBI)