Products 2247102-20-9

CAS 2247102-20-9 is the registry number for 3-{1,4-Dioxaspiro(4.5)decan-8-yl}prop-2-ynoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-(1,4-dioxaspiro[4.5]decan-8-yl)prop-2-ynoic acid (CAS 2247102-20-9) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 3-(1,4-dioxaspiro[4.5]decan-8-yl)prop-2-ynoic acid. InChIKey: GRPIOSUHXGSWLU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O4
Molecular weight210.23 g/mol
IUPAC name3-(1,4-dioxaspiro[4.5]decan-8-yl)prop-2-ynoic acid
InChIKeyGRPIOSUHXGSWLU-UHFFFAOYSA-N
SMILESC1CC2(CCC1C#CC(=O)O)OCCO2

Computed by PubChem (NCBI)