Products 2247102-83-4

CAS 2247102-83-4 is the registry number for 2-Methoxy-6-(methoxymethoxy)benzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-methoxy-6-(methoxymethoxy)benzenesulfonyl chloride (CAS 2247102-83-4) is a chemical compound with the molecular formula C9H11ClO5S and a molecular weight of 266.70 g/mol. IUPAC name: 2-methoxy-6-(methoxymethoxy)benzenesulfonyl chloride. InChIKey: GLPQTDQTNWKLEQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClO5S
Molecular weight266.70 g/mol
IUPAC name2-methoxy-6-(methoxymethoxy)benzenesulfonyl chloride
InChIKeyGLPQTDQTNWKLEQ-UHFFFAOYSA-N
SMILESCOCOC1=CC=CC(=C1S(=O)(=O)Cl)OC

Computed by PubChem (NCBI)