CAS 306936-32-3 appears in our catalog under these names: Ethyl 4-(chlorosulphonyl)-2,5-dimethyl-3-furoate, 95%, Ethyl 4-(Chlorosulphonyl)-2,5-dimethyl-3-furoate, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg.
Ethyl 4-chlorosulfonyl-2,5-dimethylfuran-3-carboxylate (CAS 306936-32-3) is a chemical compound with the molecular formula C9H11ClO5S and a molecular weight of 266.70 g/mol. IUPAC name: ethyl 4-chlorosulfonyl-2,5-dimethylfuran-3-carboxylate. InChIKey: OPVQUCBSIFLMKM-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO5S |
|---|---|
| Molecular weight | 266.70 g/mol |
| IUPAC name | ethyl 4-chlorosulfonyl-2,5-dimethylfuran-3-carboxylate |
| InChIKey | OPVQUCBSIFLMKM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC(=C1S(=O)(=O)Cl)C)C |
Computed by PubChem (NCBI)