Products 39614-62-5

CAS 39614-62-5 appears in our catalog under these names: 3,4,5–Trimethoxybenzene–1–sulfonyl chloride, 3,4,5-Trimethoxybenzene-1-sulfonyl chloride, 3,4,5-Trimethoxybenzene-1-sulfonyl chloride, 95%, 95%, 3,4,5-Trimethoxybenzene-1-sulfonyl chloride, 95%. Offered by: GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 0,5g, 50mg, 1g.

Structural formula: {0} (CAS {1})

3,4,5-trimethoxybenzenesulfonyl chloride (CAS 39614-62-5) is a chemical compound with the molecular formula C9H11ClO5S and a molecular weight of 266.70 g/mol. IUPAC name: 3,4,5-trimethoxybenzenesulfonyl chloride. InChIKey: MQSMMBMVEDEDQR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClO5S
Molecular weight266.70 g/mol
IUPAC name3,4,5-trimethoxybenzenesulfonyl chloride
InChIKeyMQSMMBMVEDEDQR-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)S(=O)(=O)Cl

Computed by PubChem (NCBI)