Products 2247104-06-7
CAS 2247104-06-7 is the registry number for rac-(2R,5S)-5-((Dimethylamino)methyl)oxolane-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2R,5S)-5-[(dimethylamino)methyl]oxolane-2-carboxylic acid;hydrochloride (CAS 2247104-06-7) is a chemical compound with the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. IUPAC name: (2R,5S)-5-[(dimethylamino)methyl]oxolane-2-carboxylic acid;hydrochloride. InChIKey: ODLXJMRVPACIBQ-UOERWJHTSA-N.
| Molecular formula | C8H16ClNO3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | (2R,5S)-5-[(dimethylamino)methyl]oxolane-2-carboxylic acid;hydrochloride |
| InChIKey | ODLXJMRVPACIBQ-UOERWJHTSA-N |
| SMILES | CN(C)C[C@@H]1CC[C@@H](O1)C(=O)O.Cl |
Computed by PubChem (NCBI)