Products 2247105-26-4
CAS 2247105-26-4 is the registry number for rac-(4aR,7aS)-Octahydro-1H-pyrrolo(3,4-b)pyridin-5-one hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4aS,7aR)-1,2,3,4,4a,6,7,7a-octahydropyrrolo[3,4-b]pyridin-5-one;hydrochloride (CAS 2247105-26-4) is a chemical compound with the molecular formula C7H13ClN2O and a molecular weight of 176.64 g/mol. IUPAC name: (4aS,7aR)-1,2,3,4,4a,6,7,7a-octahydropyrrolo[3,4-b]pyridin-5-one;hydrochloride. InChIKey: CDBNEYRYSFWIMZ-GEMLJDPKSA-N.
| Molecular formula | C7H13ClN2O |
|---|---|
| Molecular weight | 176.64 g/mol |
| IUPAC name | (4aS,7aR)-1,2,3,4,4a,6,7,7a-octahydropyrrolo[3,4-b]pyridin-5-one;hydrochloride |
| InChIKey | CDBNEYRYSFWIMZ-GEMLJDPKSA-N |
| SMILES | C1C[C@H]2[C@H](CNC2=O)NC1.Cl |
Computed by PubChem (NCBI)