Products 2247106-80-3
CAS 2247106-80-3 is the registry number for rac-(1R,3S)-3-((tert-Butoxy)carbonyl)cyclohexane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Cis-(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexane-1-carboxylic acid (CAS 2247106-80-3) is a chemical compound with the molecular formula C12H20O4 and a molecular weight of 228.28 g/mol. IUPAC name: cis-(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexane-1-carboxylic acid. InChIKey: NFRPKIATGQQKHI-DTWKUNHWSA-N.
| Molecular formula | C12H20O4 |
|---|---|
| Molecular weight | 228.28 g/mol |
| IUPAC name | cis-(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexane-1-carboxylic acid |
| InChIKey | NFRPKIATGQQKHI-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCC[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)