Products 2247451-16-5
CAS 2247451-16-5 is the registry number for 4-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (CAS 2247451-16-5) is a chemical compound with the molecular formula C13H16BFN2O2 and a molecular weight of 262.09 g/mol. IUPAC name: 4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole. InChIKey: BQBICPGYODZKFK-UHFFFAOYSA-N.
| Molecular formula | C13H16BFN2O2 |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| InChIKey | BQBICPGYODZKFK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C3=C(C=C2)NN=C3)F |
Computed by PubChem (NCBI)