CAS 2247657-28-7 is the registry number for rel-(1R,3S)-2,2-Difluoro-3-methylcyclopropane-1-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Cis-(1S,3R)-2,2-difluoro-3-methylcyclopropane-1-carboxylic acid (CAS 2247657-28-7) is a chemical compound with the molecular formula C5H6F2O2 and a molecular weight of 136.10 g/mol. IUPAC name: cis-(1S,3R)-2,2-difluoro-3-methylcyclopropane-1-carboxylic acid. InChIKey: AVEOEYKDGIQSBO-GBXIJSLDSA-N.
| Molecular formula | C5H6F2O2 |
|---|---|
| Molecular weight | 136.10 g/mol |
| IUPAC name | cis-(1S,3R)-2,2-difluoro-3-methylcyclopropane-1-carboxylic acid |
| InChIKey | AVEOEYKDGIQSBO-GBXIJSLDSA-N |
| SMILES | C[C@@H]1[C@H](C1(F)F)C(=O)O |
Computed by PubChem (NCBI)