Products 2248206-93-9

CAS 2248206-93-9 is the registry number for Rel-(1r,3r)-1-amino-3-(cyanomethyl)cyclobutane-1-carboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-amino-3-(cyanomethyl)cyclobutane-1-carboxylic acid;hydrochloride (CAS 2248206-93-9) is a chemical compound with the molecular formula C7H11ClN2O2 and a molecular weight of 190.63 g/mol. IUPAC name: 1-amino-3-(cyanomethyl)cyclobutane-1-carboxylic acid;hydrochloride. InChIKey: LXENLYLIVJJZQV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11ClN2O2
Molecular weight190.63 g/mol
IUPAC name1-amino-3-(cyanomethyl)cyclobutane-1-carboxylic acid;hydrochloride
InChIKeyLXENLYLIVJJZQV-UHFFFAOYSA-N
SMILESC1C(CC1(C(=O)O)N)CC#N.Cl

Computed by PubChem (NCBI)