CAS 2248273-11-0 is the registry number for tert-Butyl 3-sulfanyl-4H,5H,6H,7H-pyrazolo(1,5-a)pyrazine-5-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 3-sulfanyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate (CAS 2248273-11-0) is a chemical compound with the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. IUPAC name: tert-butyl 3-sulfanyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate. InChIKey: FGZFEDHFMADMJD-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2S |
|---|---|
| Molecular weight | 255.34 g/mol |
| IUPAC name | tert-butyl 3-sulfanyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
| InChIKey | FGZFEDHFMADMJD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=C(C=N2)S)C1 |
Computed by PubChem (NCBI)