Products 2248293-20-9
CAS 2248293-20-9 is the registry number for 4-(2-{((tert-Butoxy)carbonyl)amino}propyl)benzene-1,2-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phthalic acid (CAS 2248293-20-9) is a chemical compound with the molecular formula C16H21NO6 and a molecular weight of 323.34 g/mol. IUPAC name: 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phthalic acid. InChIKey: AKNULBZQJDJBIW-UHFFFAOYSA-N.
| Molecular formula | C16H21NO6 |
|---|---|
| Molecular weight | 323.34 g/mol |
| IUPAC name | 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phthalic acid |
| InChIKey | AKNULBZQJDJBIW-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C=C1)C(=O)O)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)