CAS 2248317-43-1 is the registry number for tert-Butyl 5-ethynylthiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 5-ethynylthiophene-2-carboxylate (CAS 2248317-43-1) is a chemical compound with the molecular formula C11H12O2S and a molecular weight of 208.28 g/mol. IUPAC name: tert-butyl 5-ethynylthiophene-2-carboxylate. InChIKey: OAVSLHGRGSEVKZ-UHFFFAOYSA-N.
| Molecular formula | C11H12O2S |
|---|---|
| Molecular weight | 208.28 g/mol |
| IUPAC name | tert-butyl 5-ethynylthiophene-2-carboxylate |
| InChIKey | OAVSLHGRGSEVKZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(S1)C#C |
Computed by PubChem (NCBI)