CAS 2248395-72-2 is the registry number for rac-((1R,2R)-2-(Dimethylamino)cyclopentyl)methanol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[(1R,2R)-2-(dimethylamino)cyclopentyl]methanol;hydrochloride (CAS 2248395-72-2) is a chemical compound with the molecular formula C8H18ClNO and a molecular weight of 179.69 g/mol. IUPAC name: [(1R,2R)-2-(dimethylamino)cyclopentyl]methanol;hydrochloride. InChIKey: JHOOQAFASSLHNK-KZYPOYLOSA-N.
| Molecular formula | C8H18ClNO |
|---|---|
| Molecular weight | 179.69 g/mol |
| IUPAC name | [(1R,2R)-2-(dimethylamino)cyclopentyl]methanol;hydrochloride |
| InChIKey | JHOOQAFASSLHNK-KZYPOYLOSA-N |
| SMILES | CN(C)[C@@H]1CCC[C@H]1CO.Cl |
Computed by PubChem (NCBI)