Products 2250243-12-8
CAS 2250243-12-8 appears in our catalog under these names: 3,4-Dihydro-2h-1-benzopyran-6-amine hydrochloride, 95%, Chroman–6–amine hydrochloride, Chroman-6-amine hydrochloride 95%, Chroman-6-amine hydrochloride, 95%, 95%, Chroman-6-amine hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
3,4-dihydro-2H-chromen-6-amine;hydrochloride (CAS 2250243-12-8) is a chemical compound with the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. IUPAC name: 3,4-dihydro-2H-chromen-6-amine;hydrochloride. InChIKey: MARJYYYCUUOSIK-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO |
|---|---|
| Molecular weight | 185.65 g/mol |
| IUPAC name | 3,4-dihydro-2H-chromen-6-amine;hydrochloride |
| InChIKey | MARJYYYCUUOSIK-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)N)OC1.Cl |
Computed by PubChem (NCBI)