CAS 2250340-28-2 appears in our catalog under these names: 6-Bromo-4,7-difluoroindoline-2,3-dione, 97%, 6-Bromo-4,7-difluoroindoline-2,3-dione, 95%, 95%, 6-Bromo-4,7-difluoroindoline-2,3-dione, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g.
6-bromo-4,7-difluoro-1H-indole-2,3-dione (CAS 2250340-28-2) is a chemical compound with the molecular formula C8H2BrF2NO2 and a molecular weight of 262.01 g/mol. IUPAC name: 6-bromo-4,7-difluoro-1H-indole-2,3-dione. InChIKey: VLXFXQARUKPDQK-UHFFFAOYSA-N.
| Molecular formula | C8H2BrF2NO2 |
|---|---|
| Molecular weight | 262.01 g/mol |
| IUPAC name | 6-bromo-4,7-difluoro-1H-indole-2,3-dione |
| InChIKey | VLXFXQARUKPDQK-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=C1Br)F)NC(=O)C2=O)F |
Computed by PubChem (NCBI)