CAS 874831-42-2 is the registry number for 7-Bromo-5,6-difluoro-2,3-dihydro-1H-indole-2,3-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-bromo-5,6-difluoro-1H-indole-2,3-dione (CAS 874831-42-2) is a chemical compound with the molecular formula C8H2BrF2NO2 and a molecular weight of 262.01 g/mol. IUPAC name: 7-bromo-5,6-difluoro-1H-indole-2,3-dione. InChIKey: YLSQVYKNOYXLPY-UHFFFAOYSA-N.
| Molecular formula | C8H2BrF2NO2 |
|---|---|
| Molecular weight | 262.01 g/mol |
| IUPAC name | 7-bromo-5,6-difluoro-1H-indole-2,3-dione |
| InChIKey | YLSQVYKNOYXLPY-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=C1F)F)Br)NC(=O)C2=O |
Computed by PubChem (NCBI)