CAS 874830-74-7 appears in our catalog under these names: 5-Bromo-4,6-difluoroindoline-2,3-dione, 95%, 5-Bromo-4,6-difluoroindoline-2,3-dione, 97%, 5-Bromo-4,6-difluoro-2,3-dihydro-1H-indole-2,3-dione, 5-Bromo-4,6-difluoroindoline-2,3-dione, 98%, 98%, 5-BROMO-4,6-DIFLUOROINDOLINE-2,3-DIONE, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 50mg, 0,5g, 250mg, 500mg.
5-bromo-4,6-difluoro-1H-indole-2,3-dione (CAS 874830-74-7) is a chemical compound with the molecular formula C8H2BrF2NO2 and a molecular weight of 262.01 g/mol. IUPAC name: 5-bromo-4,6-difluoro-1H-indole-2,3-dione. InChIKey: HLOUGGGNIWHBON-UHFFFAOYSA-N.
| Molecular formula | C8H2BrF2NO2 |
|---|---|
| Molecular weight | 262.01 g/mol |
| IUPAC name | 5-bromo-4,6-difluoro-1H-indole-2,3-dione |
| InChIKey | HLOUGGGNIWHBON-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=C1F)Br)F)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)