Products 2251053-29-7
CAS 2251053-29-7 appears in our catalog under these names: (6-cyclopropylpyridin-3-yl)methanamine dihydrochloride, 95%, (6-Cyclopropylpyridin-3-yl)methanamine dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 25mg.
(6-cyclopropyl-3-pyridinyl)methanamine;dihydrochloride (CAS 2251053-29-7) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: (6-cyclopropyl-3-pyridinyl)methanamine;dihydrochloride. InChIKey: HAVCTVSPMHHDSW-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | (6-cyclopropyl-3-pyridinyl)methanamine;dihydrochloride |
| InChIKey | HAVCTVSPMHHDSW-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC=C(C=C2)CN.Cl.Cl |
Computed by PubChem (NCBI)