CAS 2251133-77-2 is the registry number for Methyl 5-(1H-pyrazolo[3,4-b]pyridin-3-yl)-1H-pyrrole-3-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5-(2H-pyrazolo[3,4-b]pyridin-3-yl)-1H-pyrrole-3-carboxylate (CAS 2251133-77-2) is a chemical compound with the molecular formula C12H10N4O2 and a molecular weight of 242.23 g/mol. IUPAC name: methyl 5-(2H-pyrazolo[3,4-b]pyridin-3-yl)-1H-pyrrole-3-carboxylate. InChIKey: SPKYSDNLILCEEG-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O2 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | methyl 5-(2H-pyrazolo[3,4-b]pyridin-3-yl)-1H-pyrrole-3-carboxylate |
| InChIKey | SPKYSDNLILCEEG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CNC(=C1)C2=C3C=CC=NC3=NN2 |
Computed by PubChem (NCBI)