CAS 2252-37-1 appears in our catalog under these names: 2–Bromo–6–fluorobenzoic acid, 2-Bromo-6-fluorobenzoic acid, 97% , 2-Bromo-6-fluorobenzoic Acid, >98.0%(GC)(T), 2-Bromo-6-fluorobenzoic acid, 2-Bromo-6-fluorobenzoic acid 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth, Ambeed. Available pack sizes: 100g, 25g, 1g, 5g, 250g, 1000g, 10g, 500g.
2-bromo-6-fluorobenzoic acid (CAS 2252-37-1) is a chemical compound with the molecular formula C7H4BrFO2 and a molecular weight of 219.01 g/mol. IUPAC name: 2-bromo-6-fluorobenzoic acid. InChIKey: MDAZJVAIZVUWDE-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO2 |
|---|---|
| Molecular weight | 219.01 g/mol |
| IUPAC name | 2-bromo-6-fluorobenzoic acid |
| InChIKey | MDAZJVAIZVUWDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C(=O)O)F |
Computed by PubChem (NCBI)