Products 225240-79-9
CAS 225240-79-9 is the registry number for 4-Oxo-5,6,7,8-tetrahydro-4H-cyclohepta[b]furan-3-carboxylic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-oxo-5,6,7,8-tetrahydrocyclohepta[b]furan-3-carboxylic acid (CAS 225240-79-9) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 4-oxo-5,6,7,8-tetrahydrocyclohepta[b]furan-3-carboxylic acid. InChIKey: PXIYUIZGOHSVAZ-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 4-oxo-5,6,7,8-tetrahydrocyclohepta[b]furan-3-carboxylic acid |
| InChIKey | PXIYUIZGOHSVAZ-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C2=C(C1)OC=C2C(=O)O |
Computed by PubChem (NCBI)