Products 2253629-54-6

CAS 2253629-54-6 is the registry number for 4-Fluoro-2-(1-methyl-1H-imidazol-5-yl)benzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-fluoro-2-(3-methylimidazol-4-yl)benzoic acid;hydrochloride (CAS 2253629-54-6) is a chemical compound with the molecular formula C11H10ClFN2O2 and a molecular weight of 256.66 g/mol. IUPAC name: 4-fluoro-2-(3-methylimidazol-4-yl)benzoic acid;hydrochloride. InChIKey: NNKVQBQSZXSUSN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10ClFN2O2
Molecular weight256.66 g/mol
IUPAC name4-fluoro-2-(3-methylimidazol-4-yl)benzoic acid;hydrochloride
InChIKeyNNKVQBQSZXSUSN-UHFFFAOYSA-N
SMILESCN1C=NC=C1C2=C(C=CC(=C2)F)C(=O)O.Cl

Computed by PubChem (NCBI)