CAS 945321-32-4 is the registry number for 1-(3-Chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide (CAS 945321-32-4) is a chemical compound with the molecular formula C11H10ClFN2O2 and a molecular weight of 256.66 g/mol. IUPAC name: 1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide. InChIKey: QUPQKQZKXIKXCO-UHFFFAOYSA-N.
| Molecular formula | C11H10ClFN2O2 |
|---|---|
| Molecular weight | 256.66 g/mol |
| IUPAC name | 1-(3-chloro-4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| InChIKey | QUPQKQZKXIKXCO-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC(=C(C=C2)F)Cl)C(=O)N |
Computed by PubChem (NCBI)