CAS 2260937-01-5 is the registry number for Methyl 5-amino-4-fluoroisoquinoline-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 5-amino-4-fluoroisoquinoline-1-carboxylate;hydrochloride (CAS 2260937-01-5) is a chemical compound with the molecular formula C11H10ClFN2O2 and a molecular weight of 256.66 g/mol. IUPAC name: methyl 5-amino-4-fluoroisoquinoline-1-carboxylate;hydrochloride. InChIKey: CBQOENIFLCREIF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClFN2O2 |
|---|---|
| Molecular weight | 256.66 g/mol |
| IUPAC name | methyl 5-amino-4-fluoroisoquinoline-1-carboxylate;hydrochloride |
| InChIKey | CBQOENIFLCREIF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C(C2=C1C=CC=C2N)F.Cl |
Computed by PubChem (NCBI)