Products 2253639-27-7

CAS 2253639-27-7 is the registry number for 6-(Methoxymethyl)-1,1-dioxo-1λâ¶,2-thiazinane-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

6-(methoxymethyl)-1,1-dioxothiazinane-6-carboxylic acid (CAS 2253639-27-7) is a chemical compound with the molecular formula C7H13NO5S and a molecular weight of 223.25 g/mol. IUPAC name: 6-(methoxymethyl)-1,1-dioxothiazinane-6-carboxylic acid. InChIKey: QGSUWDYKMIMBNW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13NO5S
Molecular weight223.25 g/mol
IUPAC name6-(methoxymethyl)-1,1-dioxothiazinane-6-carboxylic acid
InChIKeyQGSUWDYKMIMBNW-UHFFFAOYSA-N
SMILESCOCC1(CCCNS1(=O)=O)C(=O)O

Computed by PubChem (NCBI)