CAS 325851-81-8 is the registry number for 3-((4-Hydroxy-1,1-dioxothiolan-3-yl)amino)propanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]propanoic acid (CAS 325851-81-8) is a chemical compound with the molecular formula C7H13NO5S and a molecular weight of 223.25 g/mol. IUPAC name: 3-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]propanoic acid. InChIKey: NXYDPTKVWOEPPC-UHFFFAOYSA-N.
| Molecular formula | C7H13NO5S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | 3-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]propanoic acid |
| InChIKey | NXYDPTKVWOEPPC-UHFFFAOYSA-N |
| SMILES | C1C(C(CS1(=O)=O)O)NCCC(=O)O |
Computed by PubChem (NCBI)