Products 325851-81-8

CAS 325851-81-8 is the registry number for 3-((4-Hydroxy-1,1-dioxothiolan-3-yl)amino)propanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

3-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]propanoic acid (CAS 325851-81-8) is a chemical compound with the molecular formula C7H13NO5S and a molecular weight of 223.25 g/mol. IUPAC name: 3-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]propanoic acid. InChIKey: NXYDPTKVWOEPPC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13NO5S
Molecular weight223.25 g/mol
IUPAC name3-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]propanoic acid
InChIKeyNXYDPTKVWOEPPC-UHFFFAOYSA-N
SMILESC1C(C(CS1(=O)=O)O)NCCC(=O)O

Computed by PubChem (NCBI)