Products 2253996-73-3
CAS 2253996-73-3 is the registry number for Antiparasitic agent-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[1-hydroxy-2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]prop-2-enyl]benzonitrile (CAS 2253996-73-3) is a chemical compound with the molecular formula C19H15N3O3 and a molecular weight of 333.3 g/mol. IUPAC name: 4-[1-hydroxy-2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]prop-2-enyl]benzonitrile. InChIKey: DGIYZLSIKDNRBQ-UHFFFAOYSA-N.
| Molecular formula | C19H15N3O3 |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | 4-[1-hydroxy-2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]prop-2-enyl]benzonitrile |
| InChIKey | DGIYZLSIKDNRBQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NOC(=N2)C(=C)C(C3=CC=C(C=C3)C#N)O |
Computed by PubChem (NCBI)
Synonyms:
Antiparasitic agent-6, orb1689035