Products 95385-38-9
CAS 95385-38-9 is the registry number for Tubulin polymerization-IN-57. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl N-(6-naphthalen-1-yloxy-1H-benzimidazol-2-yl)carbamate (CAS 95385-38-9) is a chemical compound with the molecular formula C19H15N3O3 and a molecular weight of 333.3 g/mol. IUPAC name: methyl N-(6-naphthalen-1-yloxy-1H-benzimidazol-2-yl)carbamate. InChIKey: LAYJCHAJQHFMOR-UHFFFAOYSA-N.
| Molecular formula | C19H15N3O3 |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | methyl N-(6-naphthalen-1-yloxy-1H-benzimidazol-2-yl)carbamate |
| InChIKey | LAYJCHAJQHFMOR-UHFFFAOYSA-N |
| SMILES | COC(=O)NC1=NC2=C(N1)C=C(C=C2)OC3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)
Synonyms:
Tubulin polymerization-IN-57, orb2565112