CAS 3095060-23-1 is the registry number for HDAC6-IN-66. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[3-(furan-2-yl)indazol-1-yl]methyl]-N-hydroxybenzamide (CAS 3095060-23-1) is a chemical compound with the molecular formula C19H15N3O3 and a molecular weight of 333.3 g/mol. IUPAC name: 4-[[3-(furan-2-yl)indazol-1-yl]methyl]-N-hydroxybenzamide. InChIKey: XADYZXMIBSQJCT-UHFFFAOYSA-N.
| Molecular formula | C19H15N3O3 |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | 4-[[3-(furan-2-yl)indazol-1-yl]methyl]-N-hydroxybenzamide |
| InChIKey | XADYZXMIBSQJCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN2CC3=CC=C(C=C3)C(=O)NO)C4=CC=CO4 |
Computed by PubChem (NCBI)