Products 2254498-63-8
CAS 2254498-63-8 is the registry number for methyl 2',3'-dihydro-5'H-spiro[cyclopropane-1,4'-pyrido[3,2-b][1,4]oxazepine]-8'-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl spiro[3,5-dihydro-2H-pyrido[3,2-b][1,4]oxazepine-4,1'-cyclopropane]-8-carboxylate (CAS 2254498-63-8) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: methyl spiro[3,5-dihydro-2H-pyrido[3,2-b][1,4]oxazepine-4,1'-cyclopropane]-8-carboxylate. InChIKey: FAJSUTQDMLDABV-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | methyl spiro[3,5-dihydro-2H-pyrido[3,2-b][1,4]oxazepine-4,1'-cyclopropane]-8-carboxylate |
| InChIKey | FAJSUTQDMLDABV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(NC3(CC3)CCO2)N=C1 |
Computed by PubChem (NCBI)