CAS 2254505-85-4 is the registry number for (2,8-Dimethylimidazo[1,2-b]pyridazin-6-yl)boronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)boronic acid (CAS 2254505-85-4) is a chemical compound with the molecular formula C8H10BN3O2 and a molecular weight of 191.00 g/mol. IUPAC name: (2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)boronic acid. InChIKey: DCYOOEDTKURORI-UHFFFAOYSA-N.
| Molecular formula | C8H10BN3O2 |
|---|---|
| Molecular weight | 191.00 g/mol |
| IUPAC name | (2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)boronic acid |
| InChIKey | DCYOOEDTKURORI-UHFFFAOYSA-N |
| SMILES | B(C1=NN2C=C(N=C2C(=C1)C)C)(O)O |
Computed by PubChem (NCBI)